Acamprosate Calcium
Acamprosate calcium is an agonist of GABA receptor. It can act as a modulator of glutamatergic systems and reduce alcohol consumption in animal models of alcohol addiction.
| Trivial name | Calcium N-acetylhomotaurinate |
| Catalog Number | CSN10198 |
| Alternative Name(s) | Calcium N-acetylhomotaurinate |
| Research Area | Neurological Disease |
| Molecular Formula | C10H20CaN2O8S2 |
| CAS# | 77337-73-6 |
| Purity | ≥98% |
| SMILES | O=S(CCCNC(C)=O)([O-])=O.O=S(CCCNC(C)=O)([O-])=O.[Ca+2] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/acamprosate-calcium.html |
