Acamprosate calcium
API Standard
| Catalog Number | CS-O-00924 |
| Alternative Name(s) | 3-(cetylamino)-1-propanesulfonc cidcacium Salt; Acomed; Aotal;ca-AOTA;cacium N-cetylhomotaurinate;cacium camprosate;cacium Biscetyl Homotaurine;campral c; Sobriol; |
| Research Area | Campral (acamprosate calcium) is supplied in an enteric-coated tablet for oral administration. Acamprosate calcium is a synthetic compound with a chemical structure similar to that of the endogenous amino acid homotaurine, which is a structural analogue o |
| Molecular Formula | C10H2CaN2O8S2 |
| CAS# | 77337-73-6 |
| Purity | >98% |
| SMILES | O=[S](CCCNC(C)=O)([O-])=O.O=[S](CCCNC(C)=O)([O-])=O.[Ca+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00924.html |