(E/Z)-Tamoxifen
Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-T-61374 |
| Alternative Name(s) | s;(E/Z)-Mammaton;(E/Z)-Novalde;(E/Z)-2-[4-(1,2-Diphenyl-1-butenyl)phenoxy]-N,N-dimethylethanamine; 1-[p-[2-(N,N-Dimethylamino)ethoxy] phenyl]-1,2-diphenylbut-1-ene; (E/Z)-Mammaton; (E/Z)-Novaldex; tamoxifen citrate impurity E |
| Research Area | Mixture of Tamoxifen and its (E)-isomer. |
| Molecular Formula | C26H29NO |
| CAS# | 7728-73-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC/C(C1=CC=CC=C1)=C(C2=CC=CC=C2)/C3=CC=C(OCCN(C)C)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST61374.html |
| Additional Information | NULL |