Me-IQ | MedChemExpress (MCE)
Me-IQ (Methyl-IQ), an orally active heterocyclic amine, is carcinogenic and mutagenic. Me-IQ is several hundred-fold more mutagenic in liver than in lung microsomal preparations from uninduced mice and rabbits[1][2].
| Trivial name | Me-IQ |
| Catalog Number | HY-141638 |
| Alternative Name(s) | Methyl-IQ |
| Research Area | Cancer |
| CAS# | 77094-11-2 |
| Purity | ≥98.00% |
| SMILES | NC(N1C)=NC2=C1C(C)=CC3=C2C=CC=N3 |
| PubChem Chemical Structure ID | 62274 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/me-iq.html |