Gadobutrol
Gadobutrol is used in magnetic resonance imaging (MRI) imaging to help visualize and detect vascular abnormalities in the blood brain barrier and central nervous system.
| Trivial name | ZK 135079; 138071-82-6 |
| Catalog Number | CSN11072 |
| Alternative Name(s) | ZK 135079; 138071-82-6 |
| Research Area | / |
| Molecular Formula | C15H25GaN4O9 |
| CAS# | 770691-21-9 |
| Purity | ≥99% |
| SMILES | O=C(N1CCN(C([O-])=O)CCN(C([O-])=O)CCN(C(C(O)CO)CO)CC1)[O-].[Ga+3] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/gadobutrol.html |
