Erythromycin Thiocyanate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00232 |
| Alternative Name(s) | thiocyanic acid compound with (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-(((2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-14-ethyl-7,12,13-trihydroxy-4-(((2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)ox袈袈袈袈 |
| Research Area | A preparation of erythromycin,An antimicrobial agent |
| Molecular Formula | C38H68N2O13S |
| CAS# | 7704-67-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@H](C(O[C@@H]1CC)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)[C@H]([C@](O)(C[C@H](C([C@@H]([C@@H](O)[C@@]1(O)C)C)=O)C)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O.N#CS |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00232.html |
| Additional Information | NULL |
