Triethyl Citrate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-45112 |
| Alternative Name(s) | 2-Hydroxy-1,2,3-propaneter;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| Research Area | Triethyl Citrate, is a colorless, odorless liquid used as a food additive to stabilize foams, especially as whipping aid for egg white. It is also used in pharmaceutical coatings and plastics. |
| Molecular Formula | C12H20O7 |
| CAS# | 77-93-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC(OCC)=O)(C(OCC)=O)CC(OCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST45112.html |
| Additional Information | NULL |