Cedryl acetate
Cedryl Acetate (Cedrol acetate, Cedranyl acetate), an acetylated from cedarwood oil, has been applied to chemistry for its properties as a chiral and cell signaling reagent with antifungal and immunotoxicity functions. Cedryl acetate exhibits α-glucosidase inhibitory activity.
| Trivial name | Cedrol acetate, Cedranyl acetate |
| Catalog Number | S4793 |
| Molecular Formula | C19H19Cl2N9O3 |
| CAS# | 77-54-3 |
| Inchi | InChI=1S/C19H19Cl2N9O3/c1-10(32-2)17(33-3)16-13(9-22-15-7-14(21)28-29(15)16)27-19(31)26-11-6-12(20)18(23-8-11)30-24-4-5-25-30/h4-10,17H,1-3H3,(H2,26,27,31)/t10-,17+/m1/s1 |
| Inchi Key | XKQLNDPUQSZBJW-QGHHPUGFSA-N |
| SMILES | CC(C(C1=C(C=NC2=CC(=NN21)Cl)NC(=O)NC3=CC(=C(N=C3)N4N=CC=N4)Cl)OC)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/cedryl-acetate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cedryl-acetate-chemical-structure-s4793.gif |