(+)-Cedrol
(+)-Cedrol is a crystalline hydrated product of α-cedrene, which is a sesquiterpene found in cedar-wood oil. It can be used as a fragrance ingredient in cosmetics, shampoos, and soaps as well as in non-cosmetic products such as cleaners and detergents. (±) Cedrol can be synthesized by intramolecular Diels-Alder reaction of alkyl cyclopentadiene.
| Catalog Number | CBB1115394 |
| Alternative Name(s) | (1S,2R,5S,7R,8R)-2,6,6,8-Tetramethyltricyclo[5.3.1.01.5]undecan-8-ol |
| Molecular Formula | C15H26O |
| CAS# | 77-53-2 |
| Purity | >99% |
| Inchi | 1S/C15H26O/c1-10-5-6-11-13(2,3)12-9-15(10,11)8-7-14(12,4)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12-,14-,15+/m1/s1 |
| Inchi Key | SVURIXNDRWRAFU-OGMFBOKVSA-N |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC[C@@]3(C)O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/cedrol-item-115394.html |