Ursolic acid
Ursolic acid (UA) is a hydroxyl pentacyclic triterpenoic acid (HPTA), which exhibits anti-bacterial, anti-cancer, anti-oxidative and anti-inflammatory effects. It can also promote neuroregeneration after peripheral nerve injury. UA can enhance sleep duration by activating the GABAergic neurotransmitter system. [GABA= γ-aminobutyric acid]
| Catalog Number | CBB1111782 |
| Alternative Name(s) | 3β-Hydroxy-12-ursen-28-ic acid |
| Molecular Formula | C30H48O3 |
| CAS# | 77-52-1 |
| Purity | >90% |
| Inchi | 1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
| Inchi Key | WCGUUGGRBIKTOS-GPOJBZKASA-N |
| SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])(CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@]5(CC[C@@]34C)C(O)=O)[C@@]1(C)CC[C@H](O)C2(C)C |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/ursolic-acid-item-111782.html |