Ursolic acid (Malol) 10mM * 1mL in DMSO
Ursolic acid(Malol) is a pentacyclic triterpene acid, used in cosmetics, that is also capable of inhibiting various types of cancer cells by inhibiting the STAT3 activation pathway and human fibrosarcoma cells by reducing the expression of matrix metalloproteinase-9 by acting through the glucocorticoid receptor.
Trivial name | Ursolic acid (Malol) 10mM * 1mL in DMSO |
Catalog Number | A10961-10mM-D |
Alternative Name(s) | 3??-?€?hydroxy-?€?urs-?€?12-?€?en-?€?28-?€?oic acid |
Molecular Formula | C₃₀H₄₈O₃ |
CAS# | 77-52-1 |
SMILES | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/ursolic-acid-malol.html |