Nizatidine
Histamine H2 receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1552-5.1 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C12H21N5O2S2 |
| CAS# | 76963-41-2 |
| Purity | 99.31% |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCC1=CSC(=N1)CN(C)C |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1552 |
