Campathecin
Camptothecin is a potent DNA enzyme topoisomerase I (topo I) inhibitor with an IC50 and IC70 of 50 nM and 0.225 μM for breast cancer cell line MDA-MB-231.
| Trivial name | NSC 100880; (S)-(+)-Camptothecin; Camptothecin; CPT |
| Catalog Number | CSN16581 |
| Alternative Name(s) | NSC 100880; (S)-(+)-Camptothecin; Camptothecin; CPT |
| Research Area | Cancer |
| Molecular Formula | C20H16N2O4 |
| CAS# | 7689-03-4 |
| Purity | ≥99% |
| SMILES | [C@@]5(C2=C(C(N1CC4=C(C1=C2)N=C3C=CC=CC3=C4)=O)COC5=O)(CC)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/campathecin.html |