Famotidine 13C
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02664 |
| Alternative Name(s) | (Z)-3-[({2-[(diaminomethylidene)amino]-1,3-thiazol-4- yl}methyl)sulfanyl]-N'-sulfamoyl(1- ��C)propimidamide; CS-EK-00349 |
| Research Area | Labeled Famotidine, intended for use as an internal standard for the quantification of Famotidine by GC- or LC-mass spectrometry. |
| Molecular Formula | C7[13C]H15N7O2S3 |
| CAS# | 76824-35-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N=C(N)NC1=NC(CSCC[13C](N[S](N)(=O)=O)=N)=CS1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02664.html |
| Additional Information | NULL |