1-Adamantanol | MedChemExpress (MCE)
1-Adamantanol is a cyclic molecule with a hydroxyl group that can be used as an intermediate in the synthesis of adamantane. 1-Adamantanol can be oxidized to 1,3-adamantanediol by the Streptomyces SA8 oxidation system[1].

Trivial name | 1-Adamantanol |
Catalog Number | HY-Y0531 |
Alternative Name(s) | 1-Adamantanol |
Research Area | Others |
CAS# | 768-95-6 |
Purity | ≥98.0% |
SMILES | OC12C[C@H]3C[C@@H](C2)C[C@@H](C1)C3 |
Size | 25 g |
Supplier Page | https://www.medchemexpress.com/1-adamantanol.html |