Divalproex Sodium
Divalproex Sodium, consisting of a compound of sodium valproate and valproic acid in a 1:1 molar relationship in an enteric coated form, is a HDAC inhibitor, used in the treatment for epilepsy.
| Trivial name | N/A |
| Catalog Number | S1703 |
| Molecular Formula | C19H14F2N6O |
| CAS# | 76584-70-8 |
| Inchi | InChI=1S/C19H14F2N6O/c1-27-18(22-8-23-27)15-16(9-2-4-10(20)5-3-9)24-13-7-11(21)6-12-14(13)17(15)25-26-19(12)28/h2-8,15-16,24H,1H3,(H,26,28)/t15-,16-/m1/s1 |
| Inchi Key | HWGQMRYQVZSGDQ-HZPDHXFCSA-N |
| SMILES | CN1C(=NC=N1)C2C(NC3=CC(=CC4=C3C2=NNC4=O)F)C5=CC=C(C=C5)F |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Divalproex-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Divalproex-sodium-chemical-structure-S1703.gif |
