Olaparib
Olaparib is a small molecule inhibitor of PARP1/PARP2 (IC50: 5/1 nM) but is less effective against the PARP tankyrase-1 (IC50: 1.5 μM).
| Catalog Number | T3015 |
| Alternative Name(s) | AZD2281 , KU0059436 |
| Research Area | DNA Damage/DNA Repair|||Chromatin/Epigenetic|||Autophagy |
| Molecular Formula | C24H23FN4O3 |
| CAS# | 763113-22-0 |
| Purity | 99.89% |
| SMILES | Fc1ccc(Cc2n[nH]c(=O)c3ccccc23)cc1C(=O)N1CCN(CC1)C(=O)C1CC1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Olaparib |
| Additional Information | https://www.targetmol.com/datasheet/T3015 |