Olaparib (AZD2281)
Olaparib (AZD2281, KU0059436) is a selective inhibitor of PARP1/2 with IC50 of 5 nM/1 nM in cell-free assays, 300-times less effective against tankyrase-1. Olaparib induces significant autophagy that is associated with mitophagy in cells with BRCA mutations.
| Trivial name | Ku-0059436 |
| Catalog Number | S1060 |
| Molecular Formula | C15H24O |
| CAS# | 763113-22-0 |
| Inchi | InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
| Inchi Key | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/AZD2281(Olaparib).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Olaparib-AZD2281-chemical-structure-S1060.gif |
