α,β-Thujone | MedChemExpress (MCE)
α,β-Thujone is a component of the essential oils of some plants. α,β-Thujone causes cancers in male rats and induces seizures in the highest doses[1].
| Trivial name | α,β-Thujone |
| Catalog Number | HY-W751152 |
| Research Area | Cancer |
| CAS# | 76231-76-0 |
| Purity | ≥98.00% |
| SMILES | CC([C@]12[C@](C(C(C2)=O)C)([H])C1)C |
| PubChem Chemical Structure ID | 10931629 |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/α-β-thujone.html |