Derrone
Derrone, a natural product isolated and purified from the herbs of Cudrania tricuspidata, may be interesting antimicrobial agents to be used against infectious diseases caused by many pathogens, and is an Aurora kinase inhibitor, it can significantly inhibit the formation and growth of MCF7 tumor spheroids.
| Trivial name | / |
| Catalog Number | CSN14824 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H16O5 |
| CAS# | 76166-59-1 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(O)C=C3C(C=CC(C)(C)O3)=C2OC=C1C4=CC=C(O)C=C4 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/derrone.html |