Enalapril maleate 10mM * 1mL in DMSO
Enalapril is an angiotensin converting enzyme (ACE) inhibitor used in the treatment of hypertension and some types of chronic heart failure.
| Trivial name | Enalapril maleate 10mM * 1mL in DMSO |
| Catalog Number | A10350-10mM-D |
| Alternative Name(s) | (S)-1-(N-(1-(Ethoxycarbonyl)-3-phenylpropyl)-L-alanyl)-L-proline (Z)-2-butenedioate salt |
| Molecular Formula | C20H28N2O5.C4H4O4;C24H32N2O9 |
| CAS# | 76095-16-4 |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O.C(=CC(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/enalapril-maleate.html |
