Teneligliptin
API Standard
| Catalog Number | CS-T-43286 |
| Research Area | Teneligliptin is a dipeptidyl peptidase-4 (DPP-4) inhibitor that is used to treat type 2 diabetes. Tenegliptin is eliminated from the via excretion, and has a half-life of 24.2 hours in the human body. |
| Molecular Formula | C22H30N6OS |
| CAS# | 760937-92-6 |
| Purity | >98% |
| SMILES | CC1=NN(C2=CC=CC=C2)C(N3CCN([C@H]4C[C@@H](C(N5CCSC5)=O)NC4)CC3)=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST43286.html |