Thymol blue | MedChemExpress (MCE)
Thymol Blue sodium is an acid-base indicator used to indicate changes in pH. Thymol Blue sodium fades from red to yellow at pH 1.2 to 2.8 and from yellow to blue at pH 8.0 to 9.6[1]. Storage: protect from light.
| Trivial name | Thymol blue |
| Catalog Number | HY-D0219 |
| Alternative Name(s) | Thymolsulphonephthalein |
| Research Area | Others |
| CAS# | 76-61-9 |
| Purity | ≥98.0% |
| SMILES | O=S1(OC(C2=C(C)C=C(O)C(C(C)C)=C2)(C3=C(C)C=C(O)C(C(C)C)=C3)C4=CC=CC=C41)=O |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/thymol-blue.html |