Camphor is a novel carbon nanotube precursor.
| Catalog Number | CDC10-0191 |
| Alternative Name(s) | (±)-Camphor, 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C10H16O |
| CAS# | 76-22-2 |
| Purity | 96.0% |
| Inchi | 1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| SMILES | [H][C@](CC1=O)(CC2)C(C)(C)[C@]12C |
| EC Number | 200-945-0 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/camphor-item-2273.html |
Kampfer is a waxy, flammable, white, or transparent solid with a strong aroma. It is a terpenoid with the chemical formula C10H16O.
| Catalog Number | CDC10-0262 |
| Alternative Name(s) | camphanone;(1RS,4RS)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;Caladryl;2-Kamfanon;2-CAMPHOR |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C10H16O |
| CAS# | 76-22-2 |
| Purity | 96.0% |
| Inchi | 1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| SMILES | [H][C@](CC1=O)(CC2)C(C)(C)[C@]12C |
| EC Number | 207-354-7 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/camphor-item-2344.html |
