6-Amino-5-1,3-dimethyl-5-(formamido)uracil
6-Amino-5-1,3-dimethyl-5-(formamido)uracil is a substitued uracilic metabolite of methylxanthine and is also a metabolite of Theophylline . 6-Amino-5-1,3-dimethyl-5-(formamido)uracil has been used for the synthesis of 8-arylaminotheophyllines.
| Catalog Number | CS-T-02645 |
| Alternative Name(s) | 6-Amino-5-formamido-1,3-dimethyl-uracil; Formyl 1,3-dimethyl-5,6-diaminouracil; N-(6-Amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)formamide |
| Research Area | Metabolites |
| Molecular Formula | C7H10N4O3 |
| CAS# | 7597-60-6 |
| Purity | >98% |
| SMILES | NC(N(C1=O)C)=C(C(N1C)=O)NC=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST02645.html |
