Betamethasone 21-Propionate D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14061 |
| Alternative Name(s) | (11β,16β)-9-Fluoro-11,17-dihydroxy-16-methyl-21-(1-oxopropoxy)pregna-1,4-diene-3,20-dione-d5. |
| Research Area | Labeled Betamethasone, intended for use as an internal standard for the quantification of Betamethasone by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H28D5FO6 |
| CAS# | 75883-07-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)C(COC(C([2H])([2H])C([2H])([2H])[2H])=O)=O)[C@](C[C@@H]2C)([H])[C@@](CCC3=CC4=O)([H])[C@@](F)([C@]3(C=C4)C)[C@@H](O)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14061.html |
| Additional Information | NULL |