β-Cyclodextrin
β-Cyclodextrin (β-CD, Beta-Cyclodextrin) is a cyclic derivative of starch prepared from partially hydrolyzed starch (maltodextrin) by an enzymatic process. β-Cyclodextrin can be used as complexing agents to increase aqueous solubility of poorly soluble drugs and to increase their bioavailability and stability.
| Trivial name | β-CD, Beta-Cyclodextrin |
| Catalog Number | E0046 |
| Molecular Formula | C28H25F2N3OS |
| CAS# | 7585-39-9 |
| SMILES | FC1=CC=C(C=C1)C(=C2CCN(CCN3C(=S)NC4=CC=CC=C4C3=O)CC2)C5=CC=C(F)C=C5 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/beta-cyclodextrin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0046-beta-cyclodextrin-chemical-structure.gif |
