β-Cyclodextrin
β-Cyclodextrin is a cyclic polysaccharide composed of seven units of glucose (α-D-glucopyranose) linked by α-(1,4) type bonds. β-Cyclodextrin has often been used to enhance the solubility of drugs. β-Cyclodextrin has anti-influenza virus H1N1 activities.
| Trivial name | / |
| Catalog Number | CSN25463 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C42H70O35 |
| CAS# | 7585-39-9 |
| Purity | ≥95% |
| SMILES | O[C@@H]1[C@H]([C@@H]2O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H](O[C@H]4CO)[C@@H](O)[C@H](O)[C@H]4O[C@H](O[C@H]5CO)[C@@H](O)[C@H](O)[C@H]5O[C@H](O[C@H]6CO)[C@@H](O)[C@H](O)[C@H]6O[C@H](O[C@H]7CO)[C@@H](O)[C@H](O)[C@H]7O[C@@H](O[C@@H]8CO)[C@H](O)[C@@H](O)[C@@H]8O[C@H]1O[C@@H]2CO)O)O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/b-cyclodextrin.html |