Tanespimycin (17-AAG)
Tanespimycin (17-AAG, CP127374, NSC-330507, KOS 953) is a potent HSP90 inhibitor with IC50 of 5 nM in a cell-free assay, having a 100-fold higher binding affinity for HSP90 derived from tumour cells than HSP90 from normal cells. Tanespimycin (17-AAG) induces apoptosis, necrosis, autophagy and mitophagy. Phase 3.
Trivial name | CP127374, NSC-330507, KOS 953 |
Catalog Number | S1141 |
Molecular Formula | C26H21F3N4O4 |
CAS# | 75747-14-7 |
Inchi | InChI=1S/C26H21F3N4O4/c27-15-3-5-16(6-4-15)31-24(35)26(8-9-26)25(36)32-20-12-19(29)21(13-18(20)28)37-17-7-10-30-22(11-17)33-23(34)14-1-2-14/h3-7,10-14H,1-2,8-9H2,(H,31,35)(H,32,36)(H,30,33,34) |
Inchi Key | GNNDEPIMDAZHRQ-UHFFFAOYSA-N |
SMILES | C1CC1C(=O)NC2=NC=CC(=C2)OC3=C(C=C(C(=C3)F)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F)F |
Size | 10mM/1mL |
Supplier Page | http://www.selleckchem.com/products/17-AAG(Geldanamycin).html |
Additional Information | https://file.selleck.cn/downloads/struct/17-AAG-Geldanamycin-chemical-structure-S1141.gif |