17-AAG
17-AAG is a potent HSP90 inhibitor with IC50 of 5 nM, having a 100-fold higher binding affinity for HSP90 derived from tumour cells than HSP90 from normal cells.
| Trivial name | CP-127374;Tanespimycin; NSC-330507; KOS 953 |
| Catalog Number | CSN17209 |
| Alternative Name(s) | CP-127374;Tanespimycin; NSC-330507; KOS 953 |
| Research Area | Cancer |
| Molecular Formula | C31H43N3O8 |
| CAS# | 75747-14-7 |
| Purity | ≥98% |
| SMILES | O=C(C(NC(/C(C)=C/C=C\[C@H](OC)[C@H](/C(C)=C/[C@@H]([C@H]([C@H](C[C@@H](C1)C)OC)O)C)OC(N)=O)=O)=CC2=O)C1=C2NCC=C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/17-aag.html |