Cefmenoxime HCl
Cefmenoxime HCl is a third-generation cephalosporin antibiotic which is active against most common gram-positive and gram-negative microorganisms and highly resistant to hydrolysis by β-lactamases, also is a potent inhibitor of Enterobacteriaceae.
| Trivial name | SCE-1365 HemiHCl |
| Catalog Number | CSN10572 |
| Alternative Name(s) | SCE-1365 HemiHCl |
| Research Area | Infection |
| Molecular Formula | C32H35ClN18O10S6 |
| CAS# | 75738-58-8 |
| Purity | ≥98% |
| SMILES | O=C(C1=C(CSC2=NN=NN2C)CS[C@]([H])([C@@H]3NC(/C(C4=CSC(N)=N4)=N\OC)=O)N1C3=O)O.Cl[H].O=C(C5=C(CSC6=NN=NN6C)CS[C@]([H])([C@@H]7NC(/C(C8=CSC(N)=N8)=N\OC)=O)N5C7=O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cefmenoxime-hcl.html |