Leflunomide
Leflunomide is a dihydroorotate dehydrogenase (DHODH) inhibitor with IC50 of 2.5 μM, it is a disease-modifying antirheumatic drug (DMARD) and inhibits de novo pyrimidine synthesis.
| Trivial name | HWA486; RS 34821; SU-101 |
| Catalog Number | CSN16462 |
| Alternative Name(s) | HWA486; RS 34821; SU-101 |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C12H9F3N2O2 |
| CAS# | 75706-12-6 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(C)ON=C1)NC2=CC=C(C(F)(F)F)C=C2 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/leflunomide.html |