Leflunomide 10mM * 1mL in DMSO
Leflunomide is a pyrimidine synthesis inhibitor belonging to the DMARD (disease-modifying antirheumatic drug) class of drugs. Leflunomide is used to relieve symptoms caused by rheumatoid arthritis, such as inflammation, swelling, stiffness, and joint pain.
Trivial name | Leflunomide 10mM * 1mL in DMSO |
Catalog Number | A10521-10mM-D |
Alternative Name(s) | 5-Methylisoxazole-4-(4-trifluoromethyl)carboxanilide |
Molecular Formula | C₁₂H₉F₃N₂O₂ |
CAS# | 75706-12-6 |
SMILES | CC1=C(C=NO1)C(=O)NC2=CC=C(C=C2)C(F)(F)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/leflunomide.html |