Leflunomide 100mg
Leflunomide is a pyrimidine synthesis inhibitor belonging to the DMARD (disease-modifying antirheumatic drug) class of drugs. Leflunomide is used to relieve symptoms caused by rheumatoid arthritis, such as inflammation, swelling, stiffness, and joint pain.
| Trivial name | Leflunomide 100mg |
| Catalog Number | A10521-100 |
| Alternative Name(s) | 5-Methylisoxazole-4-(4-trifluoromethyl)carboxanilide |
| Molecular Formula | C12H9F3N2O2 |
| CAS# | 75706-12-6 |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC=C(C=C2)C(F)(F)F |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/leflunomide.html |
