(+)-Usniacin
(+)-Usniacin, a naturally occurring dibenzofuran derivative isolated and purified from the Usnea diffracta Vain. with antitumoral, antiviral, antibiotic, acaricidal, antipyretic, analgesic, antioxidative and anti-inflammatory activities.
| Trivial name | D-Usnic Acid |
| Catalog Number | CSN12442 |
| Alternative Name(s) | D-Usnic Acid |
| Research Area | / |
| Molecular Formula | C18H16O7 |
| CAS# | 7562-61-0 |
| Purity | ≥95% |
| SMILES | O=C([C@@]1(C)C(OC2=C(C(C)=O)C(O)=C(C)C(O)=C12)=C3)C(C(C)=O)C3=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/(+)-usniacin.html |