Fludarabine Phosphate
Fludarabine Phosphate is an analogue of adenosine and deoxyadenosine, which is able to compete with dATP for incorporation into DNA and inhibit DNA synthesis.
| Trivial name | F-ara-A Phosphate, NSC 118218 Phosphate |
| Catalog Number | S1229 |
| Molecular Formula | C₁₇H₁₅Cl₃N₄ |
| CAS# | 75607-67-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.Cl.ClC1=CC=CC(=C1)C([N]2C=CN=C2)C3=CC4=C(C=C3)N=C[NH]4 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/Fludara.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Fludarabine-Phosphate-Fludara-chemical-structure-S1229.gif |
