Fludarabine Phosphate 10mM * 1mL in DMSO
Fludarabine or fludarabine phosphate (Fludara) is a chemotherapy drug used in the treatment of hematological malignancies (cancers of blood cells such as leukemias and lymphomas) .Fludarabine inhibits DNA synthesis by interfering with ribonucleotide reductase and DNA polymerase. It is active against both dividing and resting cells.
Trivial name | Fludarabine Phosphate 10mM * 1mL in DMSO |
Catalog Number | A10395-10mM-D |
Alternative Name(s) | 9-bata-D-Arabinofuranosyl-2-fluoroadenine phosphate |
Molecular Formula | C₁₀H₁₃FN₅O₇P |
CAS# | 75607-67-9 |
SMILES | O[C@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1nc(F)nc2N)COP(=O)(O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/fludarabine-phosphate-fludara.html |