Fludarabine Phosphate 100mg
Fludarabine or fludarabine phosphate (Fludara) is a chemotherapy drug used in the treatment of hematological malignancies (cancers of blood cells such as leukemias and lymphomas) .Fludarabine inhibits DNA synthesis by interfering with ribonucleotide reductase and DNA polymerase. It is active against both dividing and resting cells.
| Trivial name | Fludarabine Phosphate 100mg |
| Catalog Number | A10395-100 |
| Alternative Name(s) | 9-bata-D-Arabinofuranosyl-2-fluoroadenine phosphate |
| Molecular Formula | C10H13FN5O7P |
| CAS# | 75607-67-9 |
| SMILES | O[C@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1nc(F)nc2N)COP(=O)(O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/fludarabine-phosphate-fludara.html |