Regorafenib 25mg
Regorafenib (BAY 73-4506) is a multikinase inhibitor with IC50 of 17, 40 and 69 nM c-KIT, VEGFR2, B-Raf. Regorafenib (BAY 73-4506) is an orally bioavailable multikinase inhibitor targeting both the tumor and its vasculature.
| Trivial name | Regorafenib 25mg |
| Catalog Number | A10250-25 |
| Alternative Name(s) | 3-(trifluoromethyl)phenyl]carbamoyl}amino)-3-fluorophenoxy]-N-methylpyridine-2-carboxamide |
| Molecular Formula | C21H15ClF4N4O3 |
| CAS# | 755037-03-7 |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/regorafenib-bay-73-4506.html |
