Warfarin D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02624 |
| Alternative Name(s) | 4-Hydroxy coumarin D5;4-hydroxy-3-[3-oxo-1-(²H5)phenylbutyl]-2Hchromen-2-one |
| Research Area | Coumarin anticoagulant.;Labeled Warfarin, intended for use as an internal standard for the quantification of Warfarin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H11D5O4 |
| CAS# | 75472-93-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(CC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])C(C2=O)=C(C3=CC=CC=C3O2)O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02624.html |
| Additional Information | NULL |