ß-Myrcene-d6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-59035 |
| Alternative Name(s) | 7-(D3)methyl-3-methylidene(8,8,8-D3)octa-1,6-diene |
| Research Area | Found in oil of bay, verbena, hop, etc. Used as an intermediate in the manufacturing of perfume chemicals. |
| Molecular Formula | C10H10D6 |
| CAS# | 75351-99-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C(C=C)CC/C=C(C([2H])([2H])[2H])/C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59035.html |
| Additional Information | NULL |