Ronacaleret | MedChemExpress (MCE)
Ronacaleret (SB 751689) is an orally active, potent, and selective calcium-sensing receptor (CaSR) antagonist that stimulates endogenous parathyroid hormone release from the parathyroid glands. Ronacaleret (SB 751689) is used for the study of postmenopausal osteoporosis[1].
| Trivial name | Ronacaleret |
| Catalog Number | HY-14752 |
| Alternative Name(s) | SB 751689 |
| Research Area | Metabolic Disease; Endocrinology |
| CAS# | 753449-67-1 |
| Purity | ≥98.0% |
| SMILES | O=C(O)CCC1=CC(F)=C(F)C(OC[C@H](O)CNC(C)(C)CC2CC3=C(C=CC=C3)C2)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ronacaleret.html |