Lovastatin (Standard) | MedChemExpress (MCE)
Lovastatin (Standard) is the analytical standard of Lovastatin. This product is intended for research and analytical applications. Lovastatin is a cell-permeable HMG-CoA reductase inhibitor used to lower cholesterol.
| Trivial name | Lovastatin (Standard) |
| Catalog Number | HY-N0504R |
| Alternative Name(s) | Mevinolin (Standard) |
| Research Area | Cardiovascular Disease; Cancer |
| CAS# | 75330-75-5 |
| Purity | 99.94% |
| SMILES | O=C([C@@H](C)CC)O[C@@H]1[C@@]([C@H]2CC[C@@H](OC3=O)C[C@H](C3)O)([H])C(C=C[C@@H]2C)=C[C@H](C)C1 |
| PubChem Chemical Structure ID | 53232 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/lovastatin-standard.html |