Lovastatin
Lovastatin is a HMG-CoA reductase used to treat high blood cholesterol and reduce the risk of cardiovascular disease, a naturally occuring fungal metabolite.

Trivial name | MK-803; Mevinolin |
Catalog Number | CSN11335 |
Alternative Name(s) | MK-803; Mevinolin |
Research Area | Cardiovascular Disease|Metabolic Disease |
Molecular Formula | C24H36O5 |
CAS# | 75330-75-5 |
Purity | ≥98% |
SMILES | CC[C@H](C)C(O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(O3)=O)[C@@]12[H])=O |
Size | 10mg |
Supplier Page | https://www.csnpharm.com/products/lovastatin.html |