Lovastatin
Lovastatin is a HMG-CoA reductase used to treat high blood cholesterol and reduce the risk of cardiovascular disease, a naturally occuring fungal metabolite.
| Trivial name | MK-803; Mevinolin |
| Catalog Number | CSN11335 |
| Alternative Name(s) | MK-803; Mevinolin |
| Research Area | Cardiovascular Disease|Metabolic Disease |
| Molecular Formula | C24H36O5 |
| CAS# | 75330-75-5 |
| Purity | ≥98% |
| SMILES | CC[C@H](C)C(O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(O3)=O)[C@@]12[H])=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/lovastatin.html |