14,15-Leukotriene A4 methyl ester | MedChemExpress (MCE)
14,15-Leukotriene A4 methyl ester (14,15-LTA4 methyl ester) is the methyl esterified form of Leukotriene A4, which can be used for the study of biological effects of leukotrienes[1][2].
| Trivial name | 14,15-Leukotriene A4 methyl ester |
| Catalog Number | HY-163336 |
| Alternative Name(s) | 14,15-LTA4 methyl ester |
| Research Area | Inflammation/Immunology |
| CAS# | 75290-58-3 |
| Purity | ≥98.0% |
| SMILES | COC(CCC/C=C\C/C=C\C=C\C=C\[C@H]1[C@@H](O1)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/14-15-leukotriene-a4-methyl-ester.html |