Ophiopogonanone A
Ophiopogonanone A, a natural product isolated and purified from the tubers of Ophiopogon japonicus(Thunb) Ker-Gawl., has oxygen free radicals(OFRs) scavenging effects, and can scavenge hydroxyl radical(·OH) and hydrogen peroxide(H2O2) in vitro.
| Trivial name | Ophiopogonanone-A |
| Catalog Number | CSN14841 |
| Alternative Name(s) | Ophiopogonanone-A |
| Research Area | / |
| Molecular Formula | C18H16O6 |
| CAS# | 75239-63-3 |
| Purity | ≥98% |
| SMILES | O=C1[C@H](CC2=CC=C(OCO3)C3=C2)COC4=CC(O)=C(C)C(O)=C14 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ophiopogonanone-a.html |