Lovastatin acid | MedChemExpress (MCE)
Lovastatin acid (Mevinolinic acid), an active metabolite of Lovastatin, is a potent competitive HMG-CoA reductase inhibitor with a Ki of 0.6 nM[1].
| Trivial name | Lovastatin acid |
| Catalog Number | HY-122439 |
| Alternative Name(s) | Mevinolinic acid; MSD803 |
| Research Area | Cardiovascular Disease; Cancer |
| CAS# | 75225-51-3 |
| Purity | ≥98.00% |
| SMILES | O=C(C[C@@H](C[C@@H](CC[C@H]1[C@H](C=CC2=C[C@@H](C[C@@H]([C@]12[H])OC([C@H](CC)C)=O)C)C)O)O)O |
| PubChem Chemical Structure ID | 64727 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lovastatin-acid.html |