N-Nitroso-L-proline D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11223 |
| Alternative Name(s) | (S)-1-nitrosopyrrolidined3 |
| Research Area | Labeled N-Nitroso-L-proline, intended for use as an internal standard for the quantification of N-Nitroso-L-proline by GC- or LC-mass spectrometry. |
| Molecular Formula | C5H5D3N2O3 |
| CAS# | 7519-36-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=NN(CCC1([2H])[2H])[C@]1([2H])C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11223.html |
| Additional Information | NULL |