Zofenoprilat
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-06067 |
| Alternative Name(s) | NULL |
| Research Area | Zofenoprilat is an angiotensin-inhibitor converting enzyme and is the active free sulfhydryl form of zofenopril. |
| Molecular Formula | C15H19NO3S2 |
| CAS# | 75176-37-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C[C@@H](SC1=CC=CC=C1)C2)[C@@H]2C(O)=O)[C@H](C)CS |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06067.html |
| Additional Information | NULL |
